C14H12FN3O2 — CID 154566816
3-[2-(2-fluorophenoxy)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 154566816) has the molecular formula C14H12FN3O2 and a molecular weight of 273.27 g/mol. Its IUPAC name is 3-[2-(2-fluorophenoxy)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(2-fluorophenoxy)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154566816 |
| Molecular Formula | C14H12FN3O2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[2-(2-fluorophenoxy)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2[nH]ccc2ncn1CCOc1ccccc1F |
| InChI | InChI=1S/C14H12FN3O2/c15-10-3-1-2-4-12(10)20-8-7-18-9-17-11-5-6-16-13(11)14(18)19/h1-6,9,16H,7-8H2 |
| InChIKey | QBTLBBYLDILMFZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |