C16H12Cl2N2O2 — CID 973494
3-[2-(2,5-dichlorophenoxy)ethyl]quinazolin-4-one (PubChem CID 973494) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-[2-(2,5-dichlorophenoxy)ethyl]quinazolin-4-one.
| Compound Name | 3-[2-(2,5-dichlorophenoxy)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 973494 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-[2-(2,5-dichlorophenoxy)ethyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-11-5-6-13(18)15(9-11)22-8-7-20-10-19-14-4-2-1-3-12(14)16(20)21/h1-6,9-10H,7-8H2 |
| InChIKey | FNEVDISPVYRYNI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |