C17H14Br2N2O2 — CID 16614122
3-[2-(2,6-dibromo-4-methylphenoxy)ethyl]quinazolin-4-one (PubChem CID 16614122) has the molecular formula C17H14Br2N2O2 and a molecular weight of 438.12 g/mol. Its IUPAC name is 3-[2-(2,6-dibromo-4-methylphenoxy)ethyl]quinazolin-4-one.
| Compound Name | 3-[2-(2,6-dibromo-4-methylphenoxy)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 16614122 |
| Molecular Formula | C17H14Br2N2O2 |
| Molecular Weight | 438.12 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 3-[2-(2,6-dibromo-4-methylphenoxy)ethyl]quinazolin-4-one |
| SMILES | Cc1cc(Br)c(OCCn2cnc3ccccc3c2=O)c(Br)c1 |
| InChI | InChI=1S/C17H14Br2N2O2/c1-11-8-13(18)16(14(19)9-11)23-7-6-21-10-20-15-5-3-2-4-12(15)17(21)22/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | JFOSCHVAWHOQBL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |