About 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one
3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one (PubChem CID 2216206) has the molecular formula C20H22N2O5
and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one |
| PubChem CID | 2216206 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one |
| SMILES | COc1cccc(OC)c1OCCOCCn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C20H22N2O5/c1-24-17-8-5-9-18(25-2)19(17)27-13-12-26-11-10-22-14-21-16-7-4-3-6-15(16)20(22)23/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | DQNCBGXEKSPGIH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one?
The IUPAC name of 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one (CID 2216206) is 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one.
What is the SMILES notation for 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one?
The canonical SMILES for 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one is COc1cccc(OC)c1OCCOCCn1cnc2ccccc2c1=O.
What is the InChIKey of 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one?
The InChIKey is DQNCBGXEKSPGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O5/c1-24-17-8-5-9-18(25-2)19(17)27-13-12-26-11-10-22-14-21-16-7-4-3-6-15(16)20(22)23/h3-9,14H,10-13H2,1-2H3.
What are the key properties of 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one?
3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one has a molecular weight of 370.41 g/mol, XLogP of 2.51, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]quinazolin-4-one is sourced from PubChem (CID 2216206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).