C18H23N5O4S2 — CID 135482498
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[3-(azepan-1-ylsulfonyl)phenyl]acetamide (PubChem CID 135482498) has the molecular formula C18H23N5O4S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[3-(azepan-1-ylsulfonyl)phenyl]acetamide.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[3-(azepan-1-ylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135482498 |
| Molecular Formula | C18H23N5O4S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[3-(azepan-1-ylsulfonyl)phenyl]acetamide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)Nc2cccc(S(=O)(=O)N3CCCCCC3)c2)n1 |
| InChI | InChI=1S/C18H23N5O4S2/c19-15-11-16(24)22-18(21-15)28-12-17(25)20-13-6-5-7-14(10-13)29(26,27)23-8-3-1-2-4-9-23/h5-7,10-11H,1-4,8-9,12H2,(H,20,25)(H3,19,21,22,24) |
| InChIKey | ZWXBOVGLMRSCAJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |