C16H18N4O5S2 — CID 3184608
N-(4-morpholin-4-ylsulfonylphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 3184608) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3184608 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nccc(=O)[nH]1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H18N4O5S2/c21-14-5-6-17-16(19-14)26-11-15(22)18-12-1-3-13(4-2-12)27(23,24)20-7-9-25-10-8-20/h1-6H,7-11H2,(H,18,22)(H,17,19,21) |
| InChIKey | WSNZYCUINUKZRO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |