C21H17N5O2 — CID 135482683
6-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-2-imino-4-phenyl-4,5-dihydropyrimidine-3-carbonitrile (PubChem CID 135482683) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 6-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-2-imino-4-phenyl-4,5-dihydropyrimidine-3-carbonitrile.
| Compound Name | 6-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-2-imino-4-phenyl-4,5-dihydropyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 135482683 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 6-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)-2-imino-4-phenyl-4,5-dihydropyrimidine-3-carbonitrile |
| SMILES | [H]/N=C1\N=C(c2c(O)c3ccccc3n(C)c2=O)CC(c2ccccc2)N1C#N |
| InChI | InChI=1S/C21H17N5O2/c1-25-16-10-6-5-9-14(16)19(27)18(20(25)28)15-11-17(13-7-3-2-4-8-13)26(12-22)21(23)24-15/h2-10,17,23,27H,11H2,1H3/b23-21+ |
| InChIKey | UKEBYIHHTKFLBY-XTQSDGFTSA-N |
| XLogP | 2.90 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|