C20H28N2O3S — CID 135483794
4-benzyl-2-(2,2-diethoxyethylsulfanyl)-5-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 135483794) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 4-benzyl-2-(2,2-diethoxyethylsulfanyl)-5-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-benzyl-2-(2,2-diethoxyethylsulfanyl)-5-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135483794 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-benzyl-2-(2,2-diethoxyethylsulfanyl)-5-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CCOC(CSc1nc(Cc2ccccc2)c(C(C)C)c(=O)[nH]1)OCC |
| InChI | InChI=1S/C20H28N2O3S/c1-5-24-17(25-6-2)13-26-20-21-16(12-15-10-8-7-9-11-15)18(14(3)4)19(23)22-20/h7-11,14,17H,5-6,12-13H2,1-4H3,(H,21,22,23) |
| InChIKey | MOQRSTOQRYZJAY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|