C23H25IN2O3S — CID 141462116
4-[(3,4-dimethoxyphenyl)methyl]-2-[(4-iodophenyl)methylsulfanyl]-5-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 141462116) has the molecular formula C23H25IN2O3S and a molecular weight of 536.44 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-2-[(4-iodophenyl)methylsulfanyl]-5-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-2-[(4-iodophenyl)methylsulfanyl]-5-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 141462116 |
| Molecular Formula | C23H25IN2O3S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-2-[(4-iodophenyl)methylsulfanyl]-5-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(Cc2nc(SCc3ccc(I)cc3)[nH]c(=O)c2C(C)C)cc1OC |
| InChI | InChI=1S/C23H25IN2O3S/c1-14(2)21-18(11-16-7-10-19(28-3)20(12-16)29-4)25-23(26-22(21)27)30-13-15-5-8-17(24)9-6-15/h5-10,12,14H,11,13H2,1-4H3,(H,25,26,27) |
| InChIKey | XPYSLWXLWFIXCX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|