C14H19N3O2S — CID 135484939
N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]piperidine-1-carbothioamide (PubChem CID 135484939) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]piperidine-1-carbothioamide.
| Compound Name | N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 135484939 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]piperidine-1-carbothioamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=S)N2CCCCC2)c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-19-12-5-6-13(18)11(9-12)10-15-16-14(20)17-7-3-2-4-8-17/h5-6,9-10,18H,2-4,7-8H2,1H3,(H,16,20)/b15-10+ |
| InChIKey | ZZLKTDDOQDUTNM-XNTDXEJSSA-N |
| XLogP | 2.10 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|