C13H15N5O4 — CID 135486271
methyl 4-[[N'-[N'-(2-hydroxyphenyl)carbamimidoyl]carbamimidoyl]amino]-4-oxobut-2-enoate (PubChem CID 135486271) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl 4-[[N'-[N'-(2-hydroxyphenyl)carbamimidoyl]carbamimidoyl]amino]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[[N'-[N'-(2-hydroxyphenyl)carbamimidoyl]carbamimidoyl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 135486271 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | methyl 4-[[N'-[N'-(2-hydroxyphenyl)carbamimidoyl]carbamimidoyl]amino]-4-oxobut-2-enoate |
| SMILES | COC(=O)C=CC(=O)NC(N)=N/C(N)=N/c1ccccc1O |
| InChI | InChI=1S/C13H15N5O4/c1-22-11(21)7-6-10(20)17-13(15)18-12(14)16-8-4-2-3-5-9(8)19/h2-7,19H,1H3,(H5,14,15,16,17,18,20) |
| InChIKey | IGLHNAMDCJWMGK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|