C24H21Cl2N3O2S — CID 135487128
5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[4-(diethylamino)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 135487128) has the molecular formula C24H21Cl2N3O2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[4-(diethylamino)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[4-(diethylamino)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135487128 |
| Molecular Formula | C24H21Cl2N3O2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-[4-(diethylamino)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/N=C2/NC(=O)C(=Cc3ccc(-c4cc(Cl)ccc4Cl)o3)S2)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O2S/c1-3-29(4-2)17-8-6-16(7-9-17)27-24-28-23(30)22(32-24)14-18-10-12-21(31-18)19-13-15(25)5-11-20(19)26/h5-14H,3-4H2,1-2H3,(H,27,28,30) |
| InChIKey | NNAUDHYKMUYEAW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|