C28H28N4O2 — CID 135487972
5-[[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methyl]-4,8-dioxa-3,12-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,10,13,15-pentaene (PubChem CID 135487972) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 5-[[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methyl]-4,8-dioxa-3,12-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,10,13,15-pentaene.
| Compound Name | 5-[[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methyl]-4,8-dioxa-3,12-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,10,13,15-pentaene |
|---|---|
| PubChem CID | 135487972 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 5-[[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methyl]-4,8-dioxa-3,12-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,10,13,15-pentaene |
| SMILES | c1ccc2cc(CN3CCN(CC4ON=C5c6cc7cc[nH]c7cc6OCC54)CC3)ccc2c1 |
| InChI | InChI=1S/C28H28N4O2/c1-2-4-21-13-19(5-6-20(21)3-1)16-31-9-11-32(12-10-31)17-27-24-18-33-26-15-25-22(7-8-29-25)14-23(26)28(24)30-34-27/h1-8,13-15,24,27,29H,9-12,16-18H2 |
| InChIKey | IEKLFJJOPKGCDI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |