C20H23N3O4 — CID 135490759
methyl (4Z)-4-[2-[2-(1H-benzimidazol-2-yl)ethylimino]-6-oxocyclohexylidene]-4-hydroxybutanoate (PubChem CID 135490759) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (4Z)-4-[2-[2-(1H-benzimidazol-2-yl)ethylimino]-6-oxocyclohexylidene]-4-hydroxybutanoate.
| Compound Name | methyl (4Z)-4-[2-[2-(1H-benzimidazol-2-yl)ethylimino]-6-oxocyclohexylidene]-4-hydroxybutanoate |
|---|---|
| PubChem CID | 135490759 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl (4Z)-4-[2-[2-(1H-benzimidazol-2-yl)ethylimino]-6-oxocyclohexylidene]-4-hydroxybutanoate |
| SMILES | COC(=O)CC/C(O)=C1/C(=O)CCC/C1=N\CCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H23N3O4/c1-27-19(26)10-9-17(25)20-15(7-4-8-16(20)24)21-12-11-18-22-13-5-2-3-6-14(13)23-18/h2-3,5-6,25H,4,7-12H2,1H3,(H,22,23)/b20-17-,21-15+ |
| InChIKey | YLXWJBOVUHUFFR-KEYUZUICSA-N |
| XLogP | 3.06 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|