C12H9N5O4S — CID 135491399
(2E)-3-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135491399) has the molecular formula C12H9N5O4S and a molecular weight of 319.30 g/mol. Its IUPAC name is (2E)-3-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135491399 |
| Molecular Formula | C12H9N5O4S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (2E)-3-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)CS/C1=N/N=C1\C(=O)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H9N5O4S/c1-16-9(18)5-22-12(16)15-14-10-7-4-6(17(20)21)2-3-8(7)13-11(10)19/h2-4H,5H2,1H3,(H,13,14,19)/b15-12+ |
| InChIKey | RUCDYYAWTLCHKR-NTCAYCPXSA-N |
| XLogP | 0.81 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|