C18H19N5O4S — CID 135993389
(2E)-3-cyclohexyl-5-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135993389) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is (2E)-3-cyclohexyl-5-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-cyclohexyl-5-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135993389 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (2E)-3-cyclohexyl-5-methyl-2-[(Z)-(5-nitro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1S/C(=N/N=C2\C(=O)Nc3ccc([N+](=O)[O-])cc32)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C18H19N5O4S/c1-10-17(25)22(11-5-3-2-4-6-11)18(28-10)21-20-15-13-9-12(23(26)27)7-8-14(13)19-16(15)24/h7-11H,2-6H2,1H3,(H,19,20,24)/b21-18+ |
| InChIKey | QMSNAMUILBYSGY-DYTRJAOYSA-N |
| XLogP | 2.90 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|