C10H9N3O4S — CID 135492618
2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid (PubChem CID 135492618) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid.
| Compound Name | 2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid |
|---|---|
| PubChem CID | 135492618 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazinane-6-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)SC(=NN=Cc2ccco2)N1 |
| InChI | InChI=1S/C10H9N3O4S/c14-8-4-7(9(15)16)18-10(12-8)13-11-5-6-2-1-3-17-6/h1-3,5,7H,4H2,(H,15,16)(H,12,13,14) |
| InChIKey | KGFGRKWTVBCUTO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|