C10H8N3O4S- — CID 135740513
(2E,6S)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxylate (PubChem CID 135740513) has the molecular formula C10H8N3O4S- and a molecular weight of 266.26 g/mol. Its IUPAC name is (2E,6S)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxylate.
| Compound Name | (2E,6S)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxylate |
|---|---|
| PubChem CID | 135740513 |
| Molecular Formula | C10H8N3O4S- |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | (2E,6S)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazinane-6-carboxylate |
| SMILES | O=C1C[C@@H](C(=O)[O-])S/C(=N/N=C/c2ccco2)N1 |
| InChI | InChI=1S/C10H9N3O4S/c14-8-4-7(9(15)16)18-10(12-8)13-11-5-6-2-1-3-17-6/h1-3,5,7H,4H2,(H,15,16)(H,12,13,14)/p-1/b11-5+/t7-/m0/s1 |
| InChIKey | KGFGRKWTVBCUTO-AUEGDVLESA-M |
| XLogP | -0.66 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|