C16H12N4O2 — CID 135494823
4,6-dimethyl-2-oxo-1-[(2-oxo-1H-indol-3-ylidene)amino]pyridine-3-carbonitrile (PubChem CID 135494823) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 4,6-dimethyl-2-oxo-1-[(2-oxo-1H-indol-3-ylidene)amino]pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-oxo-1-[(2-oxo-1H-indol-3-ylidene)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135494823 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4,6-dimethyl-2-oxo-1-[(2-oxo-1H-indol-3-ylidene)amino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)n(N=C2C(=O)Nc3ccccc32)c(=O)c1C#N |
| InChI | InChI=1S/C16H12N4O2/c1-9-7-10(2)20(16(22)12(9)8-17)19-14-11-5-3-4-6-13(11)18-15(14)21/h3-7H,1-2H3,(H,18,19,21) |
| InChIKey | AIUIALDKKDLBQQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|