C34H41FN4O7 — CID 135495297
(24-fluoro-13,30-dihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2,20,27-triazatetracyclo[16.11.1.019,28.021,26]triaconta-1(30),4,6,10,18,20,22,24,26,28-decaen-9-yl) carbamate (PubChem CID 135495297) has the molecular formula C34H41FN4O7 and a molecular weight of 636.72 g/mol. Its IUPAC name is (24-fluoro-13,30-dihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2,20,27-triazatetracyclo[16.11.1.019,28.021,26]triaconta-1(30),4,6,10,18,20,22,24,26,28-decaen-9-yl) carbamate.
| Compound Name | (24-fluoro-13,30-dihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2,20,27-triazatetracyclo[16.11.1.019,28.021,26]triaconta-1(30),4,6,10,18,20,22,24,26,28-decaen-9-yl) carbamate |
|---|---|
| PubChem CID | 135495297 |
| Molecular Formula | C34H41FN4O7 |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | (24-fluoro-13,30-dihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2,20,27-triazatetracyclo[16.11.1.019,28.021,26]triaconta-1(30),4,6,10,18,20,22,24,26,28-decaen-9-yl) carbamate |
| SMILES | COC1C=CC=C(C)C(=O)Nc2cc3nc4cc(F)ccc4nc3c(c2O)CC(C)CC(OC)C(O)C(C)C=C(C)C1OC(N)=O |
| InChI | InChI=1S/C34H41FN4O7/c1-17-12-22-29-25(37-24-15-21(35)10-11-23(24)38-29)16-26(31(22)41)39-33(42)18(2)8-7-9-27(44-5)32(46-34(36)43)20(4)14-19(3)30(40)28(13-17)45-6/h7-11,14-17,19,27-28,30,32,40-41H,12-13H2,1-6H3,(H2,36,43)(H,39,42) |
| InChIKey | LLMJTBVATBUVHQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 166.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|