C22H22FN3O3S — CID 135496031
2-(4-fluorophenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135496031) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135496031 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-(4-fluorophenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCc3nc(-c4ccc(F)cc4)[nH]c(=O)c3C2)c(C)c1 |
| InChI | InChI=1S/C22H22FN3O3S/c1-13-10-14(2)20(15(3)11-13)30(28,29)26-9-8-19-18(12-26)22(27)25-21(24-19)16-4-6-17(23)7-5-16/h4-7,10-11H,8-9,12H2,1-3H3,(H,24,25,27) |
| InChIKey | DOTKDTGTAXJKRC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |