C11H15N7O5 — CID 135497044
4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-hydroxypyrrolo[2,3-d]triazine-5-carboximidamide (PubChem CID 135497044) has the molecular formula C11H15N7O5 and a molecular weight of 325.29 g/mol. Its IUPAC name is 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-hydroxypyrrolo[2,3-d]triazine-5-carboximidamide.
| Compound Name | 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-hydroxypyrrolo[2,3-d]triazine-5-carboximidamide |
|---|---|
| PubChem CID | 135497044 |
| Molecular Formula | C11H15N7O5 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-hydroxypyrrolo[2,3-d]triazine-5-carboximidamide |
| SMILES | N/C(=N/O)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2nnnc(N)c12 |
| InChI | InChI=1S/C11H15N7O5/c12-8(16-22)3-1-18(10-5(3)9(13)14-17-15-10)11-7(21)6(20)4(2-19)23-11/h1,4,6-7,11,19-22H,2H2,(H2,12,16)(H2,13,14,15)/t4-,6-,7-,11-/m1/s1 |
| InChIKey | LLPXQLWVUXIIRE-RPKMEZRRSA-N |
| XLogP | -2.89 |
| TPSA | 198.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|