C12H14N4O6 — CID 136842872
7-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136842872) has the molecular formula C12H14N4O6 and a molecular weight of 310.27 g/mol. Its IUPAC name is 7-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 7-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136842872 |
| Molecular Formula | C12H14N4O6 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 7-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cn([C@@H]2O[C@@H](CO)[C@@H](O)[C@H]2O)c2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C12H14N4O6/c13-9(20)4-1-16(10-6(4)11(21)15-3-14-10)12-8(19)7(18)5(2-17)22-12/h1,3,5,7-8,12,17-19H,2H2,(H2,13,20)(H,14,15,21)/t5-,7+,8+,12+/m0/s1 |
| InChIKey | LOSRKKCSRWGBII-VBKWPLKRSA-N |
| XLogP | -2.57 |
| TPSA | 163.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |