C18H12ClN3O2 — CID 135497054
6-chloro-3-(3-methyl-1,2-oxazol-5-yl)-4-phenyl-1H-1,7-naphthyridin-2-one (PubChem CID 135497054) has the molecular formula C18H12ClN3O2 and a molecular weight of 337.77 g/mol. Its IUPAC name is 6-chloro-3-(3-methyl-1,2-oxazol-5-yl)-4-phenyl-1H-1,7-naphthyridin-2-one.
| Compound Name | 6-chloro-3-(3-methyl-1,2-oxazol-5-yl)-4-phenyl-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 135497054 |
| Molecular Formula | C18H12ClN3O2 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 6-chloro-3-(3-methyl-1,2-oxazol-5-yl)-4-phenyl-1H-1,7-naphthyridin-2-one |
| SMILES | Cc1cc(-c2c(-c3ccccc3)c3cc(Cl)ncc3[nH]c2=O)on1 |
| InChI | InChI=1S/C18H12ClN3O2/c1-10-7-14(24-22-10)17-16(11-5-3-2-4-6-11)12-8-15(19)20-9-13(12)21-18(17)23/h2-9H,1H3,(H,21,23) |
| InChIKey | XDJZWOKADJPYOE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|