C15H9Cl2N3O2 — CID 5003875
5-(4-chlorophenyl)-N-(2-chloro-3-pyridinyl)-1,2-oxazole-3-carboxamide (PubChem CID 5003875) has the molecular formula C15H9Cl2N3O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2-chloro-3-pyridinyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2-chloro-3-pyridinyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 5003875 |
| Molecular Formula | C15H9Cl2N3O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2-chloro-3-pyridinyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccnc1Cl)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C15H9Cl2N3O2/c16-10-5-3-9(4-6-10)13-8-12(20-22-13)15(21)19-11-2-1-7-18-14(11)17/h1-8H,(H,19,21) |
| InChIKey | IDKCRNYMFZKQDG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|