C18H23N3O2S — CID 135497059
5-[2-(azepan-1-yl)-2-oxoethyl]-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135497059) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 5-[2-(azepan-1-yl)-2-oxoethyl]-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[2-(azepan-1-yl)-2-oxoethyl]-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135497059 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5-[2-(azepan-1-yl)-2-oxoethyl]-2-(2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1/N=C1/NC(=O)C(CC(=O)N2CCCCCC2)S1 |
| InChI | InChI=1S/C18H23N3O2S/c1-13-8-4-5-9-14(13)19-18-20-17(23)15(24-18)12-16(22)21-10-6-2-3-7-11-21/h4-5,8-9,15H,2-3,6-7,10-12H2,1H3,(H,19,20,23) |
| InChIKey | IVKJPLYWWVXHDW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|