C16H25N3O3S — CID 135989626
2-cycloheptylimino-5-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidin-4-one (PubChem CID 135989626) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-cycloheptylimino-5-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-cycloheptylimino-5-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989626 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-cycloheptylimino-5-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\C2CCCCCC2)SC1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H25N3O3S/c20-14(19-7-9-22-10-8-19)11-13-15(21)18-16(23-13)17-12-5-3-1-2-4-6-12/h12-13H,1-11H2,(H,17,18,21) |
| InChIKey | RROAAULHCKWULD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|