C19H25ClN4O2S — CID 154359157
1-(2-chlorophenyl)-1-[2-(2-cycloheptylimino-4-oxo-1,3-thiazolidin-5-yl)ethyl]urea (PubChem CID 154359157) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1-[2-(2-cycloheptylimino-4-oxo-1,3-thiazolidin-5-yl)ethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-1-[2-(2-cycloheptylimino-4-oxo-1,3-thiazolidin-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 154359157 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-(2-chlorophenyl)-1-[2-(2-cycloheptylimino-4-oxo-1,3-thiazolidin-5-yl)ethyl]urea |
| SMILES | NC(=O)N(CCC1S/C(=N\C2CCCCCC2)NC1=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H25ClN4O2S/c20-14-9-5-6-10-15(14)24(18(21)26)12-11-16-17(25)23-19(27-16)22-13-7-3-1-2-4-8-13/h5-6,9-10,13,16H,1-4,7-8,11-12H2,(H2,21,26)(H,22,23,25) |
| InChIKey | MSEOVYSHFUMPDE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|