C21H24ClN3O2S — CID 135462037
2-chloro-N-[2-[4-oxo-2-(3-tricyclo[3.3.1.03,7]nonanylimino)-1,3-thiazolidin-5-yl]ethyl]benzamide (PubChem CID 135462037) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-oxo-2-(3-tricyclo[3.3.1.03,7]nonanylimino)-1,3-thiazolidin-5-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[4-oxo-2-(3-tricyclo[3.3.1.03,7]nonanylimino)-1,3-thiazolidin-5-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 135462037 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-chloro-N-[2-[4-oxo-2-(3-tricyclo[3.3.1.03,7]nonanylimino)-1,3-thiazolidin-5-yl]ethyl]benzamide |
| SMILES | O=C(NCCC1S/C(=N/C23CC4CC(CC2C4)C3)NC1=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H24ClN3O2S/c22-16-4-2-1-3-15(16)18(26)23-6-5-17-19(27)24-20(28-17)25-21-10-12-7-13(11-21)9-14(21)8-12/h1-4,12-14,17H,5-11H2,(H,23,26)(H,24,25,27) |
| InChIKey | ULUPFSJZKHBAIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|