C24H24N4O2S2 — CID 135519511
2-(2-cyclopentylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide (PubChem CID 135519511) has the molecular formula C24H24N4O2S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is 2-(2-cyclopentylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(2-cyclopentylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135519511 |
| Molecular Formula | C24H24N4O2S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-(2-cyclopentylimino-4-oxo-1,3-thiazolidin-5-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)CC4S/C(=N/C5CCCC5)NC4=O)cc3)sc2c1 |
| InChI | InChI=1S/C24H24N4O2S2/c1-14-6-11-18-19(12-14)31-23(27-18)15-7-9-17(10-8-15)25-21(29)13-20-22(30)28-24(32-20)26-16-4-2-3-5-16/h6-12,16,20H,2-5,13H2,1H3,(H,25,29)(H,26,28,30) |
| InChIKey | MZDHZFOAYBNPCQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|