C16H21N3O2S — CID 135927418
2-[(5R)-2-[(2S)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide (PubChem CID 135927418) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[(5R)-2-[(2S)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(5R)-2-[(2S)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 135927418 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[(5R)-2-[(2S)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CC[C@H](C)/N=C1\NC(=O)[C@@H](CC(=O)Nc2ccc(C)cc2)S1 |
| InChI | InChI=1S/C16H21N3O2S/c1-4-11(3)17-16-19-15(21)13(22-16)9-14(20)18-12-7-5-10(2)6-8-12/h5-8,11,13H,4,9H2,1-3H3,(H,18,20)(H,17,19,21)/t11-,13+/m0/s1 |
| InChIKey | PMSUATMQJUVWJH-WCQYABFASA-N |
| XLogP | 2.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|