C20H21N3O2S — CID 135691400
N-(4-methylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135691400) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135691400 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(4-methylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)C[C@H]2S/C(=N/[C@H](C)c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-13-8-10-16(11-9-13)22-18(24)12-17-19(25)23-20(26-17)21-14(2)15-6-4-3-5-7-15/h3-11,14,17H,12H2,1-2H3,(H,22,24)(H,21,23,25)/t14-,17-/m1/s1 |
| InChIKey | JRCXCHUAKMGBFW-RHSMWYFYSA-N |
| XLogP | 3.67 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|