C21H23N3O2S — CID 135691430
N-(2,5-dimethylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135691430) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135691430 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(5R)-4-oxo-2-[(1R)-1-phenylethyl]imino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)C[C@H]2S/C(=N/[C@H](C)c3ccccc3)NC2=O)c1 |
| InChI | InChI=1S/C21H23N3O2S/c1-13-9-10-14(2)17(11-13)23-19(25)12-18-20(26)24-21(27-18)22-15(3)16-7-5-4-6-8-16/h4-11,15,18H,12H2,1-3H3,(H,23,25)(H,22,24,26)/t15-,18-/m1/s1 |
| InChIKey | OCLZJWUZUMCLMC-CRAIPNDOSA-N |
| XLogP | 3.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|