C15H18FN3O2S — CID 135797711
2-[(5S)-2-[(2R)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 135797711) has the molecular formula C15H18FN3O2S and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[(5S)-2-[(2R)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5S)-2-[(2R)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135797711 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[(5S)-2-[(2R)-butan-2-yl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CC[C@@H](C)/N=C1\NC(=O)[C@H](CC(=O)Nc2ccc(F)cc2)S1 |
| InChI | InChI=1S/C15H18FN3O2S/c1-3-9(2)17-15-19-14(21)12(22-15)8-13(20)18-11-6-4-10(16)5-7-11/h4-7,9,12H,3,8H2,1-2H3,(H,18,20)(H,17,19,21)/t9-,12+/m1/s1 |
| InChIKey | LZWCONRIXNXLGA-SKDRFNHKSA-N |
| XLogP | 2.54 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|