C17H27N3O3S — CID 135989290
2-cycloheptylimino-5-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one (PubChem CID 135989290) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 2-cycloheptylimino-5-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-cycloheptylimino-5-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989290 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-cycloheptylimino-5-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\C2CCCCCC2)SC1CC(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C17H27N3O3S/c21-13-8-5-9-20(11-13)15(22)10-14-16(23)19-17(24-14)18-12-6-3-1-2-4-7-12/h12-14,21H,1-11H2,(H,18,19,23) |
| InChIKey | UCMPYDAZVBQAGI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|