C17H14ClN3O5S2 — CID 135498196
[2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 135498196) has the molecular formula C17H14ClN3O5S2 and a molecular weight of 439.90 g/mol. Its IUPAC name is [2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 135498196 |
| Molecular Formula | C17H14ClN3O5S2 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | [2-methoxy-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(C=NN=C2NC(=O)CS2)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClN3O5S2/c1-25-15-8-11(9-19-21-17-20-16(22)10-27-17)2-7-14(15)26-28(23,24)13-5-3-12(18)4-6-13/h2-9H,10H2,1H3,(H,20,21,22) |
| InChIKey | DOMVFDRZTRQXBL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|