C17H15N3O5S2 — CID 135526763
[4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 135526763) has the molecular formula C17H15N3O5S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is [4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 135526763 |
| Molecular Formula | C17H15N3O5S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | [4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc(C=NN=C3NC(=O)CS3)cc2)cc1 |
| InChI | InChI=1S/C17H15N3O5S2/c1-24-13-6-8-15(9-7-13)27(22,23)25-14-4-2-12(3-5-14)10-18-20-17-19-16(21)11-26-17/h2-10H,11H2,1H3,(H,19,20,21) |
| InChIKey | WVQWVZJLRQMJMX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|