C20H12F3N3O3S — CID 135498322
2-(furan-2-ylmethylidenehydrazinylidene)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135498322) has the molecular formula C20H12F3N3O3S and a molecular weight of 431.40 g/mol. Its IUPAC name is 2-(furan-2-ylmethylidenehydrazinylidene)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(furan-2-ylmethylidenehydrazinylidene)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135498322 |
| Molecular Formula | C20H12F3N3O3S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-(furan-2-ylmethylidenehydrazinylidene)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NN=Cc2ccco2)SC1=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H12F3N3O3S/c21-20(22,23)13-4-1-3-12(9-13)16-7-6-14(29-16)10-17-18(27)25-19(30-17)26-24-11-15-5-2-8-28-15/h1-11H,(H,25,26,27) |
| InChIKey | JZZPOWMNBIETNF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|