C22H12ClF3N2O3S — CID 137065320
4-chloro-N-[(5Z)-4-oxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137065320) has the molecular formula C22H12ClF3N2O3S and a molecular weight of 476.86 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-4-oxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-4-oxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137065320 |
| Molecular Formula | C22H12ClF3N2O3S |
| Molecular Weight | 476.86 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 4-chloro-N-[(5Z)-4-oxo-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccc(Cl)cc2)S/C1=C\c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C22H12ClF3N2O3S/c23-15-6-4-12(5-7-15)19(29)27-21-28-20(30)18(32-21)11-16-8-9-17(31-16)13-2-1-3-14(10-13)22(24,25)26/h1-11H,(H,27,28,29,30)/b18-11- |
| InChIKey | BYVWJFUBUYUDOV-WQRHYEAKSA-N |
| XLogP | 6.02 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.86 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|