C21H11Cl3N2O3S — CID 137124326
4-chloro-N-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137124326) has the molecular formula C21H11Cl3N2O3S and a molecular weight of 477.76 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137124326 |
| Molecular Formula | C21H11Cl3N2O3S |
| Molecular Weight | 477.76 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccc(Cl)cc2)S/C1=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C21H11Cl3N2O3S/c22-12-6-4-11(5-7-12)19(27)25-21-26-20(28)17(30-21)10-13-8-9-16(29-13)14-2-1-3-15(23)18(14)24/h1-10H,(H,25,26,27,28)/b17-10- |
| InChIKey | XXFAWZUOGCMMDC-YVLHZVERSA-N |
| XLogP | 6.31 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.76 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|