C11H10ClNO4 — CID 135499358
methyl 7,8-dihydroxyisoquinoline-3-carboxylate;hydrochloride (PubChem CID 135499358) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is methyl 7,8-dihydroxyisoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 7,8-dihydroxyisoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 135499358 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | methyl 7,8-dihydroxyisoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cc2ccc(O)c(O)c2cn1.Cl |
| InChI | InChI=1S/C11H9NO4.ClH/c1-16-11(15)8-4-6-2-3-9(13)10(14)7(6)5-12-8;/h2-5,13-14H,1H3;1H |
| InChIKey | YGQBEVKPTRQMAI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|