C10H8N2O3 — CID 135484881
6,7-dihydroxyisoquinoline-3-carboxamide (PubChem CID 135484881) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 6,7-dihydroxyisoquinoline-3-carboxamide.
| Compound Name | 6,7-dihydroxyisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 135484881 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 6,7-dihydroxyisoquinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2cc(O)c(O)cc2cn1 |
| InChI | InChI=1S/C10H8N2O3/c11-10(15)7-1-5-2-8(13)9(14)3-6(5)4-12-7/h1-4,13-14H,(H2,11,15) |
| InChIKey | BVRMGHVXNRKAIZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|