C21H23N6O6+ — CID 135500679
2-[[4-(11-amino-13-oxo-4,10,12-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,10-trien-4-yl)benzoyl]amino]pentanedioic acid (PubChem CID 135500679) has the molecular formula C21H23N6O6+ and a molecular weight of 455.45 g/mol. Its IUPAC name is 2-[[4-(11-amino-13-oxo-4,10,12-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,10-trien-4-yl)benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-(11-amino-13-oxo-4,10,12-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,10-trien-4-yl)benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 135500679 |
| Molecular Formula | C21H23N6O6+ |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[[4-(11-amino-13-oxo-4,10,12-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,10-trien-4-yl)benzoyl]amino]pentanedioic acid |
| SMILES | Nc1nc2c(c(=O)[nH]1)[N+]1=CN(c3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)CC1CC2 |
| InChI | InChI=1S/C21H22N6O6/c22-21-24-14-6-5-13-9-26(10-27(13)17(14)19(31)25-21)12-3-1-11(2-4-12)18(30)23-15(20(32)33)7-8-16(28)29/h1-4,10,13,15H,5-9H2,(H5-,22,23,24,25,28,29,30,31,32,33)/p+1 |
| InChIKey | AYMHCEXSXUOHSN-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 181.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|