C38H48N2O6 — CID 135501207
8-(tert-butyliminomethyl)-2-[8-(tert-butyliminomethyl)-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl]-3-methyl-5-propan-2-ylnaphthalene-1,6,7-triol (PubChem CID 135501207) has the molecular formula C38H48N2O6 and a molecular weight of 628.81 g/mol. Its IUPAC name is 8-(tert-butyliminomethyl)-2-[8-(tert-butyliminomethyl)-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl]-3-methyl-5-propan-2-ylnaphthalene-1,6,7-triol.
| Compound Name | 8-(tert-butyliminomethyl)-2-[8-(tert-butyliminomethyl)-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl]-3-methyl-5-propan-2-ylnaphthalene-1,6,7-triol |
|---|---|
| PubChem CID | 135501207 |
| Molecular Formula | C38H48N2O6 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | 8-(tert-butyliminomethyl)-2-[8-(tert-butyliminomethyl)-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl]-3-methyl-5-propan-2-ylnaphthalene-1,6,7-triol |
| SMILES | Cc1cc2c(C(C)C)c(O)c(O)c(/C=N/C(C)(C)C)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(/C=N/C(C)(C)C)c2c1O |
| InChI | InChI=1S/C38H48N2O6/c1-17(2)25-21-13-19(5)27(33(43)29(21)23(31(41)35(25)45)15-39-37(7,8)9)28-20(6)14-22-26(18(3)4)36(46)32(42)24(30(22)34(28)44)16-40-38(10,11)12/h13-18,41-46H,1-12H3/b39-15+,40-16+ |
| InChIKey | BMOLBHCLSMXJJY-ZIBYCBICSA-N |
| XLogP | 9.19 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|