C46H48N2O8 — CID 177105971
3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-yl-2-[1,6,7-trihydroxy-3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-ylnaphthalen-2-yl]naphthalene-1,6,7-triol (PubChem CID 177105971) has the molecular formula C46H48N2O8 and a molecular weight of 756.90 g/mol. Its IUPAC name is 3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-yl-2-[1,6,7-trihydroxy-3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-ylnaphthalen-2-yl]naphthalene-1,6,7-triol.
| Compound Name | 3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-yl-2-[1,6,7-trihydroxy-3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-ylnaphthalen-2-yl]naphthalene-1,6,7-triol |
|---|---|
| PubChem CID | 177105971 |
| Molecular Formula | C46H48N2O8 |
| Molecular Weight | 756.90 g/mol |
| Exact Mass | 756.34 |
| IUPAC Name | 3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-yl-2-[1,6,7-trihydroxy-3-methyl-8-(2-phenoxyethyliminomethyl)-5-propan-2-ylnaphthalen-2-yl]naphthalene-1,6,7-triol |
| SMILES | Cc1cc2c(C(C)C)c(O)c(O)c(/C=N/CCOc3ccccc3)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(/C=N/CCOc3ccccc3)c2c1O |
| InChI | InChI=1S/C46H48N2O8/c1-25(2)35-31-21-27(5)37(43(51)39(31)33(41(49)45(35)53)23-47-17-19-55-29-13-9-7-10-14-29)38-28(6)22-32-36(26(3)4)46(54)42(50)34(40(32)44(38)52)24-48-18-20-56-30-15-11-8-12-16-30/h7-16,21-26,49-54H,17-20H2,1-6H3/b47-23+,48-24+ |
| InChIKey | UCBICHHDQONPAL-AXITZHBMSA-N |
| XLogP | 9.75 |
| TPSA | 164.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.90 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|