C23H28N4O4 — CID 135501778
(Z)-N-(4-acetamido-2-methoxyphenyl)-2-[(4-butylphenyl)diazenyl]-3-hydroxybut-2-enamide (PubChem CID 135501778) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (Z)-N-(4-acetamido-2-methoxyphenyl)-2-[(4-butylphenyl)diazenyl]-3-hydroxybut-2-enamide.
| Compound Name | (Z)-N-(4-acetamido-2-methoxyphenyl)-2-[(4-butylphenyl)diazenyl]-3-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 135501778 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (Z)-N-(4-acetamido-2-methoxyphenyl)-2-[(4-butylphenyl)diazenyl]-3-hydroxybut-2-enamide |
| SMILES | CCCCc1ccc(/N=N/C(C(=O)Nc2ccc(NC(C)=O)cc2OC)=C(/C)O)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-5-6-7-17-8-10-18(11-9-17)26-27-22(15(2)28)23(30)25-20-13-12-19(24-16(3)29)14-21(20)31-4/h8-14,28H,5-7H2,1-4H3,(H,24,29)(H,25,30)/b22-15-,27-26+ |
| InChIKey | ZZCOIMLZYGAMMT-AJFVATKSSA-N |
| XLogP | 5.51 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|