About (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine
(NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine (PubChem CID 135502050) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine |
| PubChem CID | 135502050 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine |
| SMILES | O/N=C(C(=N/O)\c1ccoc1)/c1ccoc1 |
| InChI | InChI=1S/C10H8N2O4/c13-11-9(7-1-3-15-5-7)10(12-14)8-2-4-16-6-8/h1-6,13-14H/b11-9-,12-10- |
| InChIKey | HSTJRKKPDHBDGA-HWAYABPNSA-N |
| XLogP | 1.93 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine (CID 135502050) is (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine is O/N=C(C(=N/O)\c1ccoc1)/c1ccoc1.
What is the InChIKey of (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine?
The InChIKey is HSTJRKKPDHBDGA-HWAYABPNSA-N. The full InChI is InChI=1S/C10H8N2O4/c13-11-9(7-1-3-15-5-7)10(12-14)8-2-4-16-6-8/h1-6,13-14H/b11-9-,12-10-.
What are the key properties of (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine?
(NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine has a molecular weight of 220.18 g/mol, XLogP of 1.93, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(2Z)-1,2-bis(furan-3-yl)-2-hydroxyiminoethylidene]hydroxylamine is sourced from PubChem (CID 135502050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).