C17H13BrN4O3 — CID 135505915
6-bromo-2-[1-(furan-2-ylmethyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one (PubChem CID 135505915) has the molecular formula C17H13BrN4O3 and a molecular weight of 401.22 g/mol. Its IUPAC name is 6-bromo-2-[1-(furan-2-ylmethyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 6-bromo-2-[1-(furan-2-ylmethyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135505915 |
| Molecular Formula | C17H13BrN4O3 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 6-bromo-2-[1-(furan-2-ylmethyl)-3-hydroxy-5-imino-2H-pyrrol-4-yl]-3H-quinazolin-4-one |
| SMILES | [H]/N=C1/C(c2nc3ccc(Br)cc3c(=O)[nH]2)=C(O)CN1Cc1ccco1 |
| InChI | InChI=1S/C17H13BrN4O3/c18-9-3-4-12-11(6-9)17(24)21-16(20-12)14-13(23)8-22(15(14)19)7-10-2-1-5-25-10/h1-6,19,23H,7-8H2,(H,20,21,24)/b19-15- |
| InChIKey | SUFKHNDFJMALNH-CYVLTUHYSA-N |
| XLogP | 3.04 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|