C11H15N2O2S+ — CID 135508587
3-hydroxy-5,5-dimethyl-2-(3-methylthiadiazol-3-ium-5-yl)cyclohex-2-en-1-one (PubChem CID 135508587) has the molecular formula C11H15N2O2S+ and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-(3-methylthiadiazol-3-ium-5-yl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-(3-methylthiadiazol-3-ium-5-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135508587 |
| Molecular Formula | C11H15N2O2S+ |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-(3-methylthiadiazol-3-ium-5-yl)cyclohex-2-en-1-one |
| SMILES | C[n+]1cc(C2=C(O)CC(C)(C)CC2=O)sn1 |
| InChI | InChI=1S/C11H14N2O2S/c1-11(2)4-7(14)10(8(15)5-11)9-6-13(3)12-16-9/h6H,4-5H2,1-3H3/p+1 |
| InChIKey | OJWZXLNRQPFROT-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 54.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|