C26H21ClN6O2 — CID 135510246
1-(4-chlorophenyl)-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea (PubChem CID 135510246) has the molecular formula C26H21ClN6O2 and a molecular weight of 484.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea |
|---|---|
| PubChem CID | 135510246 |
| Molecular Formula | C26H21ClN6O2 |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea |
| SMILES | Cc1c(/N=C2\N=C(NC(=O)Nc3ccc(Cl)cc3)c3ccccc32)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H21ClN6O2/c1-16-22(25(34)33(32(16)2)19-8-4-3-5-9-19)29-23-20-10-6-7-11-21(20)24(30-23)31-26(35)28-18-14-12-17(27)13-15-18/h3-15H,1-2H3,(H2,28,29,30,31,35) |
| InChIKey | XMKAQFGHWULRAG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|